| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:04 UTC |
|---|
| Update Date | 2025-03-21 18:28:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074327 |
|---|
| Frequency | 40.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9N2O7P |
|---|
| Molecular Mass | 276.0147 |
|---|
| SMILES | O=c1ccn(C2OC3C(OP3(=O)O)C2O)c(=O)[nH]1 |
|---|
| InChI Key | XIVIMWJUIDNPKO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphosphacyclic compoundsphosphonic acid esterssecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | lactammonosaccharidepyrimidonephosphacyclephosphonic acid estersaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganophosphonic acid derivativealcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
