| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:05:07 UTC |
|---|
| Update Date | 2025-03-21 18:28:51 UTC |
|---|
| HMDB ID | HMDB0240537 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074446 |
|---|
| Name | Isorhamnetin 3-sulfate |
|---|
| Frequency | 39.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O10S |
|---|
| Molecular Mass | 396.0151 |
|---|
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OS(=O)(=O)O)ccc1O |
|---|
| InChI Key | CZFNXFXZXWDYMZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | sulfated flavonoids |
|---|
| Direct Parent | 3-sulfated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-o-methylated flavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersanisolesarylsulfateschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativessulfuric acid monoestersvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoesterether1-benzopyran1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranonearylsulfateorganoheterocyclic compoundbenzopyranorganic sulfuric acid or derivatives3-sulfated flavonoidheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidmethoxybenzene3p-methoxyflavonoid-skeletonoxacyclevinylogous acidorganic oxygen compoundpyrananisole7-hydroxyflavonoid4'-hydroxyflavonoidsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|