| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:09 UTC |
|---|
| Update Date | 2025-03-21 18:28:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074514 |
|---|
| Frequency | 39.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H23N3O7 |
|---|
| Molecular Mass | 393.1536 |
|---|
| SMILES | NC(CC(=O)O)C(=O)N1CCCC1C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
|---|
| InChI Key | GGRSYTUJHAZTFN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic polymers |
|---|
| Class | polypeptides |
|---|
| Subclass | polypeptides |
|---|
| Direct Parent | polypeptides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesn-acyl-alpha amino acidsn-acylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspeptidesphenylalanine and derivativesphenylpropanoic acidsproline and derivativespyrrolidinecarboxamidessecondary carboxylic acid amidestertiary carboxylic acid amidestyrosine and derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compound3-phenylpropanoic-acidn-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativealpha peptideorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesproline or derivativespolypeptidetyrosine or derivativesalpha-amino acid amideazacyclen-acyl-alpha-amino acidcarboxamide groupsecondary carboxylic acid amidepyrrolidine carboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compounddicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundpyrrolidine-2-carboxamideorganooxygen compound |
|---|