| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:11 UTC |
|---|
| Update Date | 2025-03-21 18:28:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074575 |
|---|
| Frequency | 39.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O3 |
|---|
| Molecular Mass | 254.0943 |
|---|
| SMILES | O=C1CCC(c2ccccc2)(c2ccc(O)cc2)O1 |
|---|
| InChI Key | GUICSOZCGADURM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidscarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | diphenylmethanecarbonyl grouparomatic heteromonocyclic compoundtetrahydrofuran1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativegamma butyrolactonelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|