| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:11 UTC |
|---|
| Update Date | 2025-03-21 18:28:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074595 |
|---|
| Frequency | 39.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22O |
|---|
| Molecular Mass | 194.1671 |
|---|
| SMILES | CC1=CC2CC(O)C(C)(C)C1C2(C)C |
|---|
| InChI Key | RKTRZAZCUWYBAL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclic alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativessecondary alcohols |
|---|
| Substituents | secondary alcoholhydrocarbon derivativecyclic alcoholaliphatic homopolycyclic compound |
|---|
