| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:14 UTC |
|---|
| Update Date | 2025-03-21 18:28:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074718 |
|---|
| Frequency | 39.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O9 |
|---|
| Molecular Mass | 236.0168 |
|---|
| SMILES | O=C(O)CC(O)(C(=O)O)C(C(=O)O)C(=O)O |
|---|
| InChI Key | JFZUVUQUMFJWCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalpha hydroxy acids and derivativescarboxylic acidshydrocarbon derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidtetracarboxylic acid or derivativeshydroxy acidtertiary alcoholorganic oxideorganic oxygen compoundhydrocarbon derivative1,3-dicarbonyl compoundorganooxygen compound |
|---|
