| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:19 UTC |
|---|
| Update Date | 2025-03-21 18:28:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074877 |
|---|
| Frequency | 39.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H14O9S |
|---|
| Molecular Mass | 334.0359 |
|---|
| SMILES | O=C(CCC(Cc1ccc(O)c(O)c1)C(=O)O)OS(=O)(=O)O |
|---|
| InChI Key | XQCXCBWQNDHIKS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesbranched fatty acidscarbocyclic fatty acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativeshydroxy fatty acidsorganic oxidesshort-chain hydroxy acids and derivativessulfuric acid monoesters |
|---|
| Substituents | fatty acylcarbocyclic fatty acidmonocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acidshort-chain hydroxy acid3-phenylpropanoic-acid1-hydroxy-2-unsubstituted benzenoidfatty acidcarboxylic acid derivativeorganic oxidehydroxy fatty acidorganic sulfuric acid or derivatives1-hydroxy-4-unsubstituted benzenoidbranched fatty acidaromatic homomonocyclic compoundorganic oxygen compounddicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidsulfuric acid esterorganooxygen compound |
|---|