| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:20 UTC |
|---|
| Update Date | 2025-03-21 18:28:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00074932 |
|---|
| Frequency | 39.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O5 |
|---|
| Molecular Mass | 222.0528 |
|---|
| SMILES | CC(=O)Oc1ccc(CC(=O)C(=O)O)cc1 |
|---|
| InChI Key | YOJVGKARMQUXBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpyruvic acid derivatives |
|---|
| Direct Parent | phenylpyruvic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesphenol estersphenoxy compoundsphenylpropanoic acids |
|---|
| Substituents | carbonyl groupcarboxylic acidphenylpyruvate3-phenylpropanoic-acidalpha-hydroxy ketonecarboxylic acid derivativeketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundketo acidcarboxylic acid esterphenol esteralpha-keto aciddicarboxylic acid or derivativeshydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
