| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:22 UTC |
|---|
| Update Date | 2025-03-21 18:28:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075004 |
|---|
| Frequency | 39.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O5 |
|---|
| Molecular Mass | 298.0841 |
|---|
| SMILES | CC(C(=O)O)c1cccc(C(=O)c2ccccc2C(=O)O)c1 |
|---|
| InChI Key | GMZNHABMEPKPDU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsaryl ketonesaryl-phenylketonesbenzoic acidsbenzoyl derivativesdicarboxylic acids and derivativesdiphenylmethaneshydrocarbon derivativesorganic oxidesphenylpropanoic acids |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidaryl-phenylketonebenzoylbenzoic acid or derivativescarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compound2-phenylpropanoic-aciddicarboxylic acid or derivativeshydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compoundaryl ketone |
|---|
