| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:25 UTC |
|---|
| Update Date | 2025-03-21 18:29:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075149 |
|---|
| Frequency | 39.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H6O8S |
|---|
| Molecular Mass | 213.9783 |
|---|
| SMILES | O=C(O)CC(O)(C(=O)O)S(=O)(=O)O |
|---|
| InChI Key | KBKPZJIPQDPSHG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | thia fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativeshydroxy fatty acidsorganic oxidesorganosulfonic acidsshort-chain hydroxy acids and derivativessulfonyls |
|---|
| Substituents | aliphatic acyclic compoundorganosulfonic acid or derivativescarbonyl groupcarboxylic acidshort-chain hydroxy acidalpha-hydroxy acidorganosulfonic acidhydroxy acidorganosulfur compoundcarboxylic acid derivativeorganic oxidethia fatty acidsulfonylorganic oxygen compoundorganic sulfonic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativehydroxy fatty acidorganooxygen compound |
|---|
