| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:26 UTC |
|---|
| Update Date | 2025-03-21 18:29:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075158 |
|---|
| Frequency | 39.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14N2O5S2 |
|---|
| Molecular Mass | 378.0344 |
|---|
| SMILES | NS(=O)(=O)c1ccc(Nc2cccc3cccc(S(=O)(=O)O)c23)cc1 |
|---|
| InChI Key | NIIZWKCKZVOVNI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-naphthalene sulfonates1-sulfo,2-unsubstituted aromatic compoundsaminosulfonyl compoundsarylsulfonic acids and derivativesbenzenesulfonamidesbenzenesulfonyl compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonamidesorganosulfonic acidssecondary amines |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyorganosulfonic acidorganosulfur compound1-naphthalene sulfonic acid or derivativesorganosulfonic acid amide1-naphthalene sulfonateorganic oxideorganonitrogen compoundorganopnictogen compoundbenzenesulfonyl groupbenzenesulfonamide1-sulfo,2-unsubstituted aromatic compoundaminosulfonyl compoundaromatic homopolycyclic compoundsecondary aminesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesnaphthalene sulfonatehydrocarbon derivativeorganic nitrogen compoundamine |
|---|
