| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:27 UTC |
|---|
| Update Date | 2025-03-21 18:29:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075193 |
|---|
| Frequency | 39.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C38H49N3O6 |
|---|
| Molecular Mass | 643.3621 |
|---|
| SMILES | CCC1=C(C)C(CC2=NC(=Cc3c(CC)c(C)c(CC4NC(=O)C(CC)=C4C)c(C)c3CCC(=O)O)C(CCC(=O)O)=C2C)NC1=O |
|---|
| InChI Key | XOHMRVVPNDDEOI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesketimineslactamsorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundspyrrolinessecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | ketiminemonocyclic benzene moietycarbonyl grouplactamcarboxylic acidaromatic heteromonocyclic compound3-phenylpropanoic-acidiminecarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundxyleneorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazacyclem-xyleneorganic 1,3-dipolar compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundpyrrolinedicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|