| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:05:27 UTC |
|---|
| Update Date | 2025-03-21 18:29:01 UTC |
|---|
| HMDB ID | HMDB0033991 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075205 |
|---|
| Name | Daidzin |
|---|
| Frequency | 39.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O9 |
|---|
| Molecular Mass | 416.1107 |
|---|
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(OC3OC(CO)C(O)C(O)C3O)ccc12 |
|---|
| InChI Key | KYQZWONCHDNPDP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflavonoid o-glycosides |
|---|
| Direct Parent | isoflavonoid o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersprimary alcoholspyranones and derivativessecondary alcohols |
|---|
| Substituents | phenol ethermonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidisoflavonoid-7-o-glycosidemonosaccharidesaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundpyranoneoxaneprimary alcoholorganoheterocyclic compoundisoflavonealcoholbenzopyranheteroaromatic compoundisoflavonoid o-glycosideoxacycleorganic oxygen compoundpyransecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
