| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:31 UTC |
|---|
| Update Date | 2025-03-21 18:29:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075345 |
|---|
| Frequency | 39.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N3O8P |
|---|
| Molecular Mass | 321.0362 |
|---|
| SMILES | Nc1ccn(C2OOC(CO)C3OP(=O)(O)OC32)c(=O)n1 |
|---|
| InChI Key | ZYOUOKLVVUJHAN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-dioxanesazacyclic compoundsdialkyl peroxidesdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary amines |
|---|
| Substituents | pyrimidoneorganic oxidearomatic heteropolycyclic compounddialkyl peroxideorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamalcoholcarbonic acid derivativeazacycleheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineortho-dioxaneorganooxygen compound |
|---|
