| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:32 UTC |
|---|
| Update Date | 2025-03-21 18:29:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075388 |
|---|
| Frequency | 39.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17O11P |
|---|
| Molecular Mass | 332.0508 |
|---|
| SMILES | CC(OC1OC(COP(=O)(O)O)C(O)C(O)C1O)C(=O)O |
|---|
| InChI Key | XKXIYAUJRKYRLK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesacetalphosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhexose phosphatehydrocarbon derivativeoxaneorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compound |
|---|