| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:34 UTC |
|---|
| Update Date | 2025-03-21 18:29:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075472 |
|---|
| Frequency | 39.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H23NO20P4 |
|---|
| Molecular Mass | 612.9764 |
|---|
| SMILES | CC(=O)NC1C(OC(C)C(=O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C(OP(=O)(O)O)C1OP(=O)(O)O |
|---|
| InChI Key | KHAGHHYXGDNPPY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acidscyclitols and derivativesdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupethercarboxylic acidcyclitol or derivativescarboxamide groupcarboxylic acid derivativedialkyl ethersecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphateorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundacetamideorganooxygen compound |
|---|
