| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:34 UTC |
|---|
| Update Date | 2025-03-21 18:29:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075497 |
|---|
| Frequency | 39.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H22N2O12P+ |
|---|
| Molecular Mass | 465.0905 |
|---|
| SMILES | O=C(O)CCC(NC(=O)c1cc[n+](C2OC(COP(=O)(O)O)C(O)C2O)cc1)C(=O)O |
|---|
| InChI Key | JTVWTFRKARZJHH-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyridine nucleotides |
|---|
| Subclass | pyridine nucleotides |
|---|
| Direct Parent | pyridine nucleotides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglutamic acid and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonoalkyl phosphatesmonosaccharidesn-acyl-alpha amino acidsorganic cationsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspentose phosphatespyridinecarboxylic acids and derivativessecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | pyridine carboxylic acid or derivativescarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundpentose phosphatemonosaccharidepentose-5-phosphatealpha-amino acid or derivativescarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganic cationorganoheterocyclic compound1,2-dioln-acyl-alpha amino acid or derivativespyridine nucleotidealcoholazacyclen-acyl-alpha-amino acidtetrahydrofuranheteroaromatic compoundhydroxypyridineglutamic acid or derivativescarboxamide groupoxacyclesecondary carboxylic acid amidepyridineorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|