| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:37 UTC |
|---|
| Update Date | 2025-03-21 18:29:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075621 |
|---|
| Frequency | 39.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O7 |
|---|
| Molecular Mass | 254.0427 |
|---|
| SMILES | COc1cc(C(=O)O)ccc1OC(=O)CC(=O)O |
|---|
| InChI Key | JGVLEUMGKLYPHS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidshydrocarbon derivativesmethoxybenzenesorganic oxidesphenol estersphenoxy compoundstricarboxylic acids and derivatives |
|---|
| Substituents | phenol ethercarbonyl groupethercarboxylic acidbenzoyltricarboxylic acid or derivativesalkyl aryl ethercarboxylic acid derivativemethoxybenzenearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundanisolecarboxylic acid esterphenol esterhydrocarbon derivativebenzoic acidphenoxy compoundm-methoxybenzoic acid or derivativesorganooxygen compound |
|---|