| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:39 UTC |
|---|
| Update Date | 2025-03-21 18:29:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075694 |
|---|
| Frequency | 39.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H15NO2 |
|---|
| Molecular Mass | 241.1103 |
|---|
| SMILES | O=C(O)CNC(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | SRJQBBLGTWTOEB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidscarbonyl compoundscarboxylic acidsdialkylamineshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compounds |
|---|
| Substituents | diphenylmethanesecondary aliphatic aminecarbonyl groupcarboxylic acidamino acid or derivativesamino acidalpha-amino acid or derivativessecondary aminecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
