| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 00:05:45 UTC |
|---|
| Update Date | 2025-03-21 18:29:09 UTC |
|---|
| HMDB ID | HMDB0250624 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00075916 |
|---|
| Name | Cyclic apt |
|---|
| Frequency | 61.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N5O5PS |
|---|
| Molecular Mass | 345.0297 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(O)(=S)OC2C1O |
|---|
| InChI Key | SMPNJFHAPJOHPP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofuransthiophosphate diesters |
|---|
| Substituents | thiophosphoric acid estermonosaccharidepyrimidineorganic thiophosphoric acid or derivativessaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundthiophosphate diesteroxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
