| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:51 UTC |
|---|
| Update Date | 2025-03-21 18:29:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076180 |
|---|
| Frequency | 38.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O6 |
|---|
| Molecular Mass | 298.1165 |
|---|
| SMILES | Nc1ccc(C(=O)NC2C(O)OC(CO)C(O)C2O)cc1 |
|---|
| InChI Key | UJLJFJNXSDFTRQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzamidesbenzoyl derivativescarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholsprimary aminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundamino acid or derivativesbenzoylmonosaccharidecarboxylic acid derivativebenzamiden-acyl-alpha-hexosamineorganic oxideorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholbenzoic acid or derivativescarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamine |
|---|
