| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:51 UTC |
|---|
| Update Date | 2025-03-21 18:29:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076190 |
|---|
| Frequency | 38.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H20O5 |
|---|
| Molecular Mass | 364.1311 |
|---|
| SMILES | Oc1ccc2ccc(C3OCC4C(c5ccc(O)c(O)c5)OCC34)cc2c1 |
|---|
| InChI Key | VXXUPQKLJFKYTK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | furanoid lignans |
|---|
| Subclass | furan lignans |
|---|
| Direct Parent | furan lignans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethersfurofuran lignansfurofuranshydrocarbon derivativesnaphthols and derivativesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietyetherfurofuran lignan skeletontetrahydrofuran1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoiddialkyl etheroxacyclefuran lignan skeletonnaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundfurofuranphenolhydrocarbon derivativebenzenoid2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|