| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:55 UTC |
|---|
| Update Date | 2025-03-21 18:29:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076334 |
|---|
| Frequency | 38.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N3O10P |
|---|
| Molecular Mass | 395.073 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(COP(=O)(O)O)OC1n1ccc(=O)[nH]c1=O |
|---|
| InChI Key | NNBXUHHOTUXVKE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetamidesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | carbonyl grouplactamaromatic heteromonocyclic compoundmonosaccharidepyrimidonecarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundoxaneacetamide1,2-diolalcoholvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
