| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:56 UTC |
|---|
| Update Date | 2025-03-21 18:29:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076381 |
|---|
| Frequency | 38.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O7 |
|---|
| Molecular Mass | 206.0427 |
|---|
| SMILES | O=C(O)C12OCC(O1)C(O)C(O)C2O |
|---|
| InChI Key | WGQDQIOZQRHXTO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesketalsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesoxepanessecondary alcohols |
|---|
| Substituents | meta-dioxolanecarbonyl groupcarboxylic acidmonosaccharidecarboxylic acid derivativealiphatic heteropolycyclic compoundbeta-hydroxy acidsaccharideorganic oxideacetalketaloxanealcoholpyran carboxylic acid or derivativeshydroxy acidoxepaneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
