| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:05:56 UTC |
|---|
| Update Date | 2025-03-21 18:29:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076389 |
|---|
| Frequency | 38.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C29H32N2O4 |
|---|
| Molecular Mass | 472.2362 |
|---|
| SMILES | COc1ccc(NC=O)c(C(=O)CCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)c1 |
|---|
| InChI Key | GPIFEYIPFLCNPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalkyl-phenylketonesamino acids and derivativesanilidesanisolesaromatic alcoholsaryl alkyl ketonesazacyclic compoundsbenzoyl derivativesbeta-amino ketonescarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesn-arylamidesorganic oxidesorganopnictogen compoundsphenoxy compoundspiperidinessecondary carboxylic acid amidestertiary alcoholstrialkylaminesvinylogous amides |
|---|
| Substituents | aromatic alcoholdiphenylmethanephenol ethercarbonyl groupetheraryl alkyl ketonearomatic heteromonocyclic compoundamino acid or derivativesbenzoyln-arylamidealkyl aryl ethercarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundorganopnictogen compoundbeta-aminoketonepiperidinetertiary amineorganoheterocyclic compoundalcoholvinylogous amideazacycletertiary aliphatic aminecarboxamide groupmethoxybenzenephenylketoneanilidesecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundaminealkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
