| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:00 UTC |
|---|
| Update Date | 2025-03-21 18:29:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076544 |
|---|
| Frequency | 38.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H41NO4 |
|---|
| Molecular Mass | 515.3036 |
|---|
| SMILES | CC(C)(C(=O)O)c1ccc(C(O)CCCN2CCCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
|---|
| InChI Key | DNDQNLFIMAVZTG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsaromatic alcoholsazacyclic compoundsazepanescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenylbutylaminesphenylpropanessecondary alcoholstertiary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholdiphenylmethanecarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidcarboxylic acid derivativephenylpropaneorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundalcoholazacycletertiary aliphatic aminetertiary alcoholmonocarboxylic acid or derivativesazepaneorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
