| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-21 00:06:02 UTC |
|---|
| Update Date | 2025-03-21 18:29:17 UTC |
|---|
| HMDB ID | HMDB0002095 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076648 |
|---|
| Name | Malonylcarnitine |
|---|
| Frequency | 38.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18NO6+ |
|---|
| Molecular Mass | 248.1129 |
|---|
| SMILES | C[N+](C)(C)CC(CC(=O)O)OC(=O)CC(=O)O |
|---|
| InChI Key | ZGNBLKBZJBJFDG-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | acyl carnitines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acid esterscarboxylic acidshydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium saltstricarboxylic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidtetraalkylammonium saltquaternary ammonium salttricarboxylic acid or derivativescarboxylic acid derivativeacyl-carnitineorganic oxideorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamineorganooxygen compound |
|---|
