| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:08 UTC |
|---|
| Update Date | 2025-03-21 18:29:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076871 |
|---|
| Frequency | 38.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21N7O4 |
|---|
| Molecular Mass | 387.1655 |
|---|
| SMILES | CC(O)C(=O)NC(=O)c1ccc(NCC2CNc3[nH]c(N)nc(=O)c3N2)cc1 |
|---|
| InChI Key | UUSBIHZZJVEKIQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzoic acids and derivativesbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativesdicarboximidesheteroaromatic compoundshydrocarbon derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundsphenylalkylaminesprimary aminespyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupamino acid or derivativesbenzoylpyrimidonecarboxylic acid derivativepyrimidinecarboxylic acid imide, n-unsubstitutedorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximidealcoholvinylogous amidepterinazacycleheteroaromatic compoundbenzoic acid or derivativessecondary aminesecondary aliphatic/aromatic aminecarboxylic acid imideorganic oxygen compoundsecondary alcoholphenylalkylaminehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
