| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:08 UTC |
|---|
| Update Date | 2025-03-21 18:29:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076882 |
|---|
| Frequency | 38.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H18O8 |
|---|
| Molecular Mass | 386.1002 |
|---|
| SMILES | COc1cc(C2c3cc4c(cc3C(O)C3COC(=O)C23)OCO4)cc(O)c1O |
|---|
| InChI Key | UCILNJOMIKDJGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan lactones |
|---|
| Subclass | podophyllotoxins |
|---|
| Direct Parent | podophyllotoxins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalkyl aryl ethersanisolesaryltetralin lignansbenzodioxolescarbonyl compoundscarboxylic acid estersfuranonaphthodioxolesgamma butyrolactoneshydrocarbon derivativesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenoxy compoundssecondary alcoholstetrahydrofuranstetralins |
|---|
| Substituents | linear furanonaphthodioxoletetralinphenol ethermonocyclic benzene moietycarbonyl groupetherpodophyllotoxinmethoxyphenol1-hydroxy-2-unsubstituted benzenoid1-aryltetralin lignanalkyl aryl ethercarboxylic acid derivativelactoneorganic oxideacetalaromatic heteropolycyclic compoundorganoheterocyclic compoundbenzodioxolealcoholnaphthofurantetrahydrofuran1-hydroxy-4-unsubstituted benzenoidmethoxybenzenegamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid estersecondary alcoholphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|