| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:11 UTC |
|---|
| Update Date | 2025-03-21 18:29:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00076997 |
|---|
| Frequency | 38.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H12NO9P |
|---|
| Molecular Mass | 273.025 |
|---|
| SMILES | NC(COP(=O)(O)OCC(O)C(=O)O)C(=O)O |
|---|
| InChI Key | QNKNFHFTZLUFIQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl phosphatesdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary alcoholssugar acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidephosphoethanolaminesaccharideorganic oxideglyceric_acidorganonitrogen compoundalpha-amino acidorganopnictogen compoundalcoholhydroxy aciddialkyl phosphateorganic oxygen compoundphosphoric acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
