| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:16 UTC |
|---|
| Update Date | 2025-03-21 18:29:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077181 |
|---|
| Frequency | 38.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H29NO2 |
|---|
| Molecular Mass | 291.2198 |
|---|
| SMILES | COc1ccc(C(C(C)N(C)C)C2(O)CCCCC2)cc1 |
|---|
| InChI Key | GVECSBBAEREMLA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsalkyl aryl ethersanisolescyclic alcohols and derivativescyclohexanolshydrocarbon derivativesmethoxybenzenesorganopnictogen compoundsphenoxy compoundsphenylpropanestertiary alcoholstrialkylamines |
|---|
| Substituents | phenol etheretheralkyl aryl etherphenylpropaneorganonitrogen compoundorganopnictogen compoundamphetamine or derivativestertiary aminealcohol1,3-aminoalcoholtertiary aliphatic aminecyclohexanolcyclic alcoholmethoxybenzenearomatic homomonocyclic compoundtertiary alcoholorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|
