| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:17 UTC |
|---|
| Update Date | 2025-03-21 18:29:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077229 |
|---|
| Frequency | 38.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20N2O3S |
|---|
| Molecular Mass | 284.1195 |
|---|
| SMILES | CCN(CC(=O)Nc1c(C)cccc1C)S(C)(=O)=O |
|---|
| InChI Key | WYCWPORTGGRYPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsanilidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-arylamidesorganic oxidesorganic sulfonamidesorganopnictogen compoundsorganosulfonamidessecondary carboxylic acid amidesm-xylenes |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietycarbonyl groupn-arylamideorganosulfur compoundorganosulfonic acid amidexyleneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundaminosulfonyl compoundm-xylenecarboxamide grouparomatic homomonocyclic compoundanilidesecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganic sulfonic acid amideorganooxygen compound |
|---|