| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:18 UTC |
|---|
| Update Date | 2025-03-21 18:29:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077288 |
|---|
| Frequency | 75.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16N6O5 |
|---|
| Molecular Mass | 324.1182 |
|---|
| SMILES | Nc1nc(=O)c2nc(CNC3OC(CO)C(O)C3O)cnc2[nH]1 |
|---|
| InChI Key | PKOHRSPGQXCHCV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkylamineshemiaminalsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminespyrazinespyrimidonessecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | monosaccharidepyrimidonehemiaminalpyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholvinylogous amidesecondary aliphatic aminepterinazacycletetrahydrofuranheteroaromatic compoundsecondary amineoxacycleorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
