| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:18 UTC |
|---|
| Update Date | 2025-03-21 18:29:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077294 |
|---|
| Frequency | 38.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H22O6 |
|---|
| Molecular Mass | 334.1416 |
|---|
| SMILES | CC1C(Oc2ccc3ccc(=O)oc3c2)OC(C(O)O)C(C)C1C |
|---|
| InChI Key | WDHMBDPEXBIHAX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarin glycosides |
|---|
| Direct Parent | coumarin glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyransacetalscarbonyl hydratesheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundsoxanesphenol etherspyranones and derivatives |
|---|
| Substituents | coumarin-7-o-glycosidephenol etherbenzopyrancoumarin o-glycosidecarbonyl hydrate1-benzopyranheteroaromatic compoundlactoneoxacycleorganic oxideorganic oxygen compoundacetalaromatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoidoxaneorganoheterocyclic compoundorganooxygen compound |
|---|
