| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:22 UTC |
|---|
| Update Date | 2025-03-21 18:29:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077438 |
|---|
| Frequency | 37.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18O10 |
|---|
| Molecular Mass | 310.09 |
|---|
| SMILES | O=C(OC1CC(O)(C(=O)O)CC(O)C1O)C(O)C(O)CO |
|---|
| InChI Key | FMFWUSSBFOAKJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | tannins |
|---|
| Subclass | hydrolyzable tannins |
|---|
| Direct Parent | hydrolyzable tannins |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidscyclohexanolsdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesmonosaccharidesorganic oxidesprimary alcoholsquinic acids and derivativestertiary alcohols |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharidecarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxideprimary alcoholhydrolyzable tanninalcoholcyclohexanolcyclitol or derivativeshydroxy acidcyclic alcoholfatty acid estertertiary alcoholorganic oxygen compoundcarboxylic acid estersecondary alcoholaliphatic homomonocyclic compounddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compoundquinic acid |
|---|