| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:24 UTC |
|---|
| Update Date | 2025-03-21 18:29:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077533 |
|---|
| Frequency | 37.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8N2O4 |
|---|
| Molecular Mass | 196.0484 |
|---|
| SMILES | Nc1ccc(C(=O)O)c(C(=O)O)c1N |
|---|
| InChI Key | SKWTVENEYZYQLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsamino acidsbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminesvinylogous amides |
|---|
| Substituents | vinylogous amidecarboxylic acidamino acid or derivativesamino acidbenzoylcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary amine1-carboxy-2-haloaromatic compoundorganic nitrogen compoundbenzoic acidamineorganooxygen compound |
|---|