| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:06:25 UTC |
|---|
| Update Date | 2025-03-21 18:29:28 UTC |
|---|
| HMDB ID | HMDB0130366 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077563 |
|---|
| Name | 6-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-chromen-4-one |
|---|
| Frequency | 37.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O6 |
|---|
| Molecular Mass | 314.079 |
|---|
| SMILES | COc1cc(-c2coc3cc(OC)c(O)cc3c2=O)ccc1O |
|---|
| InChI Key | CFIDZJHIHZZPGI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | o-methylated isoflavonoids |
|---|
| Direct Parent | 7-o-methylisoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisoleschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonesisoflavonoidsmethoxybenzenesmethoxyphenolsorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compound7-o-methylisoflavoneisoflavonebenzopyranheteroaromatic compoundmethoxybenzeneoxacycleorganic oxygen compoundpyrananisolephenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|