| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:25 UTC |
|---|
| Update Date | 2025-03-21 18:29:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077576 |
|---|
| Frequency | 37.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13N2O7P |
|---|
| Molecular Mass | 280.046 |
|---|
| SMILES | O=P(O)(O)OCC1OC(n2cccn2)C(O)C1O |
|---|
| InChI Key | GDILNIYJKGZHRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrazole ribonucleosides and ribonucleotidespyrazolessecondary alcoholstetrahydrofurans |
|---|
| Substituents | aromatic heteromonocyclic compoundpentose phosphatepentose-5-phosphatepyrazole1-ribofuranosylpyrazoleorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazole1,2-diolalcoholazacycletetrahydrofuranheteroaromatic compoundoxacyclephosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|