| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:25 UTC |
|---|
| Update Date | 2025-03-21 18:29:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077598 |
|---|
| Frequency | 37.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15FN2O |
|---|
| Molecular Mass | 222.1168 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(F)cc2)CC1 |
|---|
| InChI Key | UZEZNYRFOKQIKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinesaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesfluorobenzeneshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganofluoridesorganopnictogen compoundstertiary carboxylic acid amides |
|---|
| Substituents | aryl fluoridemonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganohalogen compoundfluorobenzeneorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineacetamideazacycleorganofluorideaniline or substituted anilinescarboxamide grouparyl halidephenylpiperazineorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneaminen-arylpiperazineorganooxygen compound |
|---|
