| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:26 UTC |
|---|
| Update Date | 2025-03-21 18:29:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077600 |
|---|
| Frequency | 37.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H17N3O8 |
|---|
| Molecular Mass | 307.1016 |
|---|
| SMILES | CN(CC(=O)O)C(=N)NC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | HFDXJFQNEKPIQO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | n-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsbeta hydroxy acids and derivativescarbonyl compoundscarboximidamidescarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativesguanidineshydrocarbon derivativesiminesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidguanidineiminemonosaccharidealpha-amino acid or derivativescarboxylic acid derivativepyran carboxylic acidn-glucuronidebeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativescarboximidamidehydroxy acidoxacyclepyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compound |
|---|
