| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:27 UTC |
|---|
| Update Date | 2025-03-21 18:29:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077653 |
|---|
| Frequency | 37.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O8S |
|---|
| Molecular Mass | 263.994 |
|---|
| SMILES | COc1cc(O)c(C(=O)OS(=O)(=O)O)cc1O |
|---|
| InChI Key | OQUSTYZMSDGOSD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-methoxybenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesbenzoic acids and derivativesbenzoyl derivativeshydrocarbon derivativeshydroquinonesmethoxybenzenesmethoxyphenolsmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundssalicylic acid and derivativessulfuric acid monoestersvinylogous acids |
|---|
| Substituents | phenol ethersulfuric acid monoesterethermethoxyphenolbenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativeorganic oxideorganic sulfuric acid or derivativesmethoxybenzenehydroquinonearomatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativesp-methoxybenzoic acid or derivativesanisolephenolhydrocarbon derivativephenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
