| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:28 UTC |
|---|
| Update Date | 2025-03-21 18:29:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077698 |
|---|
| Frequency | 37.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15NO4S |
|---|
| Molecular Mass | 257.0722 |
|---|
| SMILES | O=S(=O)(O)Oc1cccc(CC2CCCN2)c1 |
|---|
| InChI Key | HDCYUKDQMYYUIK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkylamineshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsphenoxy compoundspyrrolidinessulfuric acid monoesters |
|---|
| Substituents | secondary aliphatic aminemonocyclic benzene moietysulfuric acid monoesteraromatic heteromonocyclic compoundazacyclesecondary aminephenylsulfateorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterpyrrolidineorganoheterocyclic compoundorganooxygen compoundamine |
|---|