| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:29 UTC |
|---|
| Update Date | 2025-03-21 18:29:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077748 |
|---|
| Frequency | 37.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O13PS |
|---|
| Molecular Mass | 353.9658 |
|---|
| SMILES | O=C(O)C1OC(OP(=O)(O)O)C(OS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | JCKFYSPWKCPKLS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfatesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcarboxylic acidglucuronic acid or derivativesmonosaccharidecarboxylic acid derivativepyran carboxylic acidbeta-hydroxy acidorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundoxaneorganoheterocyclic compound1,2-diolalcoholpyran carboxylic acid or derivativesorganic sulfuric acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativesphosphoric acid esterpyranmonoalkyl phosphatesecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganic phosphoric acid derivativealkyl phosphate |
|---|
