| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:30 UTC |
|---|
| Update Date | 2025-03-21 18:29:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077776 |
|---|
| Frequency | 37.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H17N3O |
|---|
| Molecular Mass | 219.1372 |
|---|
| SMILES | CN1CCN(C(=O)c2ccc(N)cc2)CC1 |
|---|
| InChI Key | WTBSUAXLZLAHPE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesn-methylpiperazinesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | aromatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativebenzamideorganic oxidepiperazinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundazacyclen-alkylpiperazinetertiary aliphatic aminen-methylpiperazinecarboxamide grouporganic oxygen compound1,4-diazinanehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
