| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:33 UTC |
|---|
| Update Date | 2025-03-21 18:29:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00077919 |
|---|
| Frequency | 37.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H20NO4+ |
|---|
| Molecular Mass | 338.1387 |
|---|
| SMILES | COc1cc2c(cc1O)-c1cc3ccc(OC)c(OC)c3c[n+]1CC2 |
|---|
| InChI Key | YYFOFDHQVIODOQ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | protoberberine alkaloids and derivatives |
|---|
| Subclass | protoberberine alkaloids and derivatives |
|---|
| Direct Parent | protoberberine alkaloids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridinesalkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesisoquinolines and derivativesmethylpyridinesorganic cationsorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinesquinolizines |
|---|
| Substituents | tetrahydroprotoberberine skeletonphenol etheretherpolyhalopyridine1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridineorganic cationorganoheterocyclic compoundquinolizineazacycleheteroaromatic compoundhydroxypyridinemethylpyridineprotoberberine skeletonpyridineorganic oxygen compoundanisoleisoquinolinehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|