| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:38 UTC |
|---|
| Update Date | 2025-03-21 18:29:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078126 |
|---|
| Frequency | 37.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H21N3O8 |
|---|
| Molecular Mass | 431.1329 |
|---|
| SMILES | O=C(O)CNC(=O)C(Cc1ccc(O)cc1)N=CC=C1C=C(C(=O)O)NC(C(=O)O)C1 |
|---|
| InChI Key | WRRLSEJEVYMZSB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaldiminesalpha amino acid amidesalpha amino acidsamino acidsamphetamines and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acidsdialkylaminesfatty amideshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenylalanine and derivativespropargyl-type 1,3-dipolar organic compoundssecondary carboxylic acid amidestetrahydropyridinestricarboxylic acids and derivativestyrosine and derivatives |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acidiminefatty amide1-hydroxy-2-unsubstituted benzenoidtricarboxylic acid or derivativespropargyl-type 1,3-dipolar organic compoundaldimineorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundamphetamine or derivativessecondary aliphatic aminetyrosine or derivativesalpha-amino acid amideazacycletetrahydropyridineorganic 1,3-dipolar compoundsecondary aminecarboxamide groupn-acylglycinesecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|