DeepMet

Record Information
HMDB Status	expected
Creation Date	2024-02-21 00:06:42 UTC
Update Date	2025-03-21 18:29:35 UTC
HMDB ID	HMDB0041936
Metabolite Identification
DeepMet ID	DMID00078257
Name	Morphine-3-glucuronide
Frequency	37.4
Structure
Chemical Formula	C₂₃H₂₇NO₉
Molecular Mass	461.1686
SMILES	CN1CCC23c4c5ccc(OC6OC(C(=O)O)C(O)C(O)C6O)c4OC2C(O)C=CC3C1C5
InChI Key	WAEXKFONHRHFBZ-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	alkaloids and derivatives
Class	morphinans
Subclass	morphinans
Direct Parent	morphinans
Geometric Descriptor	aromatic heteropolycyclic compounds
Alternative Parents	acetals alkyl aryl ethers alkyl glycosides amino acids azacyclic compounds beta hydroxy acids and derivatives carbonyl compounds carboxylic acids coumarans fatty acyl glycosides of mono- and disaccharides glucuronic acid derivatives hydrocarbon derivatives monocarboxylic acids and derivatives monosaccharides o-glucuronides organic oxides organopnictogen compounds oxacyclic compounds oxanes phenanthrenes and derivatives phenol ethers piperidines pyran carboxylic acids secondary alcohols tetralins trialkylamines
Substituents	tetralin fatty acyl glycoside of mono- or disaccharide phenol ether carbonyl group ether carboxylic acid glucuronic acid or derivatives amino acid or derivatives amino acid o-glucuronide monosaccharide alkyl aryl ether carboxylic acid derivative pyran carboxylic acid 1-o-glucuronide beta-hydroxy acid saccharide organic oxide acetal aromatic heteropolycyclic compound organonitrogen compound organopnictogen compound oxane piperidine tertiary amine organoheterocyclic compound coumaran alcohol phenanthrene pyran carboxylic acid or derivatives azacycle tertiary aliphatic amine hydroxy acid oxacycle monocarboxylic acid or derivatives organic oxygen compound pyran secondary alcohol hydrocarbon derivative benzenoid organic nitrogen compound morphinan amine organooxygen compound alkyl glycoside

Showing information for DMID00078257