| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:06:42 UTC |
|---|
| Update Date | 2025-03-21 18:29:35 UTC |
|---|
| HMDB ID | HMDB0303772 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078261 |
|---|
| Name | 4-Hydroxybenzoic acid glucoside |
|---|
| Frequency | 37.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16O8 |
|---|
| Molecular Mass | 300.0845 |
|---|
| SMILES | O=C(O)c1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | XSSDYIMYZONMBL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | phenol ethercarboxylic acidaromatic heteromonocyclic compoundbenzoylmonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetalbenzoic acidoxaneprimary alcoholorganoheterocyclic compoundalcoholoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
