| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:44 UTC |
|---|
| Update Date | 2025-03-21 18:29:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078353 |
|---|
| Frequency | 37.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H26O3 |
|---|
| Molecular Mass | 278.1882 |
|---|
| SMILES | CC(=O)OCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
|---|
| InChI Key | UJQUIYGYEMWYBS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzyloxycarbonyls |
|---|
| Direct Parent | benzyloxycarbonyls |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenolsphenylpropanes |
|---|
| Substituents | benzyloxycarbonylcarbonyl groupcarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenolhydrocarbon derivativeorganooxygen compound |
|---|
