| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:06:45 UTC |
|---|
| Update Date | 2025-03-21 18:29:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00078413 |
|---|
| Frequency | 61.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9NO5S |
|---|
| Molecular Mass | 219.0201 |
|---|
| SMILES | O=C(O)CC1SCC(C(=O)O)NC1=O |
|---|
| InChI Key | RAJFNUXPCSRMQI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersdicarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidesthiomorpholine carboxylic acids and derivatives |
|---|
| Substituents | 1,4-thiazinanecarbonyl grouplactamcarboxylic acidazacycledialkylthioethercarboxamide groupsecondary carboxylic acid amideorganic oxideorganic oxygen compoundthioetheraliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundthiomorpholine-3-carboxylic acidorganoheterocyclic compoundorganooxygen compound |
|---|